C33H23FIrN2O2S-2 — CID 165170283
CID 165170283 (PubChem CID 165170283) has the molecular formula C33H23FIrN2O2S-2 and a molecular weight of 722.84 g/mol.
| Compound Name | CID 165170283 |
|---|---|
| PubChem CID | 165170283 |
| Molecular Formula | C33H23FIrN2O2S-2 |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 723.11 |
| IUPAC Name | — |
| SMILES | Cc1c[c-]c(-c2cc(C)c(C)cn2)cc1.O=S1(=O)c2ccc[c-]c2-c2nccc3c2c1cc1ccc(F)cc13.[Ir] |
| InChI | InChI=1S/C19H9FNO2S.C14H14N.Ir/c20-12-6-5-11-9-17-18-13(15(11)10-12)7-8-21-19(18)14-3-1-2-4-16(14)24(17,22)23;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-2,4-10H;4-6,8-9H,1-3H3;/q2*-1; |
| InChIKey | YSTXIKHSPXKJTP-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|