C36H43GeIrN2O2- — CID 176878589
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-(6-trimethylgermylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile (PubChem CID 176878589) has the molecular formula C36H43GeIrN2O2- and a molecular weight of 800.58 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-(6-trimethylgermylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-(6-trimethylgermylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 176878589 |
| Molecular Formula | C36H43GeIrN2O2- |
| Molecular Weight | 800.58 g/mol |
| Exact Mass | 802.22 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-(6-trimethylgermylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[Ge](C)(C)c1ccc2c(-c3[c-]c4ccccc4c(C#N)c3)nccc2c1.[Ir] |
| InChI | InChI=1S/C23H19GeN2.C13H24O2.Ir/c1-24(2,3)20-8-9-22-17(14-20)10-11-26-23(22)18-12-16-6-4-5-7-21(16)19(13-18)15-25;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-11,13-14H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | VHAXKCHUMMXRNU-DZTQYQPZSA-N |
| XLogP | 9.14 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.58 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|