C37H41IrN4O2- — CID 164783306
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-isocyanoquinazoline-8-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164783306) has the molecular formula C37H41IrN4O2- and a molecular weight of 765.98 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-isocyanoquinazoline-8-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-isocyanoquinazoline-8-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164783306 |
| Molecular Formula | C37H41IrN4O2- |
| Molecular Weight | 765.98 g/mol |
| Exact Mass | 766.29 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-isocyanoquinazoline-8-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[C-]#[N+]c1cc(C#N)c2ncnc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)c2c1.[Ir] |
| InChI | InChI=1S/C24H17N4.C13H24O2.Ir/c1-24(2,3)21-11-16(9-15-7-5-6-8-19(15)21)22-20-12-18(26-4)10-17(13-25)23(20)28-14-27-22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-8,10-12,14H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | NOFFYHJKLROEON-DZTQYQPZSA-N |
| XLogP | 9.84 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.98 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|