C41H52IrN3O2S- — CID 164796362
6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164796362) has the molecular formula C41H52IrN3O2S- and a molecular weight of 843.17 g/mol. Its IUPAC name is 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164796362 |
| Molecular Formula | C41H52IrN3O2S- |
| Molecular Weight | 843.17 g/mol |
| Exact Mass | 843.34 |
| IUPAC Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)Cc1nc(-c2cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncc2C#N)cs1.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C28H28N3S.C13H24O2.Ir/c1-27(2,3)14-26-31-25(17-32-26)22-13-24(30-16-20(22)15-29)19-11-18-9-7-8-10-21(18)23(12-19)28(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-10,12-13,16-17H,14H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | BUHJSHLZIHPGHS-DZTQYQPZSA-N |
| XLogP | 11.45 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.17 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|