C45H57IrN2O2- — CID 164796323
6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[4-(2,2-dimethylpropyl)-2-methylphenyl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164796323) has the molecular formula C45H57IrN2O2- and a molecular weight of 850.18 g/mol. Its IUPAC name is 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[4-(2,2-dimethylpropyl)-2-methylphenyl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[4-(2,2-dimethylpropyl)-2-methylphenyl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164796323 |
| Molecular Formula | C45H57IrN2O2- |
| Molecular Weight | 850.18 g/mol |
| Exact Mass | 850.41 |
| IUPAC Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[4-(2,2-dimethylpropyl)-2-methylphenyl]pyridine-3-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(CC(C)(C)C)ccc1-c1cc(-c2[c-]c3ccccc3c(C(C)(C)C)c2)ncc1C#N.[Ir] |
| InChI | InChI=1S/C32H33N2.C13H24O2.Ir/c1-21-14-22(18-31(2,3)4)12-13-26(21)28-17-30(34-20-25(28)19-33)24-15-23-10-8-9-11-27(23)29(16-24)32(5,6)7;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-14,16-17,20H,18H2,1-7H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | MFRCNWOPEHTAAY-DZTQYQPZSA-N |
| XLogP | 12.30 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.18 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|