C39H40IrNO2SSi- — CID 171764327
[4-[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]phenyl]-trimethylsilane;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 171764327) has the molecular formula C39H40IrNO2SSi- and a molecular weight of 807.12 g/mol. Its IUPAC name is [4-[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]phenyl]-trimethylsilane;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | [4-[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]phenyl]-trimethylsilane;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 171764327 |
| Molecular Formula | C39H40IrNO2SSi- |
| Molecular Weight | 807.12 g/mol |
| Exact Mass | 807.22 |
| IUPAC Name | [4-[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]phenyl]-trimethylsilane;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC(C)(C)c1cc(-c2nccc3sc4cc(-c5ccc([Si](C)(C)C)cc5)ccc4c23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C34H32NSSi.C5H8O2.Ir/c1-34(2,3)29-20-25(19-24-9-7-8-10-27(24)29)33-32-28-16-13-23(21-31(28)36-30(32)17-18-35-33)22-11-14-26(15-12-22)37(4,5)6;1-4(6)3-5(2)7;/h7-18,20-21H,1-6H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | NEPPGMAPYKXZFW-LWFKIUJUSA-N |
| XLogP | 10.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.12 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|