C36H34NO2Pt- — CID 170539469
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5-(4-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 170539469) has the molecular formula C36H34NO2Pt- and a molecular weight of 707.75 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5-(4-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5-(4-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 170539469 |
| Molecular Formula | C36H34NO2Pt- |
| Molecular Weight | 707.75 g/mol |
| Exact Mass | 707.22 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5-(4-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.CC(C)(C)c1cc(-c2ccc(-c3ccc(-c4ccccc4)cc3)cn2)[c-]c2ccccc12.[Pt] |
| InChI | InChI=1S/C31H26N.C5H8O2.Pt/c1-31(2,3)29-20-27(19-25-11-7-8-12-28(25)29)30-18-17-26(21-32-30)24-15-13-23(14-16-24)22-9-5-4-6-10-22;1-4(6)3-5(2)7;/h4-18,20-21H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DHYCROUTCHOPGE-LWFKIUJUSA-N |
| XLogP | 9.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.75 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|