C54H38F6IrNO2- — CID 59356180
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59356180) has the molecular formula C54H38F6IrNO2- and a molecular weight of 1039.11 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59356180 |
| Molecular Formula | C54H38F6IrNO2- |
| Molecular Weight | 1039.11 g/mol |
| Exact Mass | 1039.24 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.FC(F)(F)c1[c-]c(-c2ccc(-c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)cn2)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C49H30F6N.C5H8O2.Ir/c50-48(51,52)39-28-38(29-40(30-39)49(53,54)55)41-27-26-37(31-56-41)47-45(35-22-12-4-13-23-35)43(33-18-8-2-9-19-33)42(32-16-6-1-7-17-32)44(34-20-10-3-11-21-34)46(47)36-24-14-5-15-25-36;1-4(6)3-5(2)7;/h1-28,30-31H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RHCVYQFKYDCBSI-LWFKIUJUSA-N |
| XLogP | 15.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.11 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|