C30H31FGeIrNO2- — CID 171764468
[4-[5-fluoro-2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 171764468) has the molecular formula C30H31FGeIrNO2- and a molecular weight of 721.41 g/mol. Its IUPAC name is [4-[5-fluoro-2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | [4-[5-fluoro-2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 171764468 |
| Molecular Formula | C30H31FGeIrNO2- |
| Molecular Weight | 721.41 g/mol |
| Exact Mass | 723.12 |
| IUPAC Name | [4-[5-fluoro-2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(-c2cc(-c3ccc([Ge](C)(C)C)cc3)c(F)cn2)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C25H23FGeN.C5H8O2.Ir/c1-17-13-20(14-19-7-5-6-8-22(17)19)25-15-23(24(26)16-28-25)18-9-11-21(12-10-18)27(2,3)4;1-4(6)3-5(2)7;/h5-13,15-16H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | QUUYTKFOOBDZRH-LWFKIUJUSA-N |
| XLogP | 7.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.41 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|