C37H32FIrN2O2- — CID 176751456
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-fluorophenyl)benzo[c][2,7]naphthyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 176751456) has the molecular formula C37H32FIrN2O2- and a molecular weight of 747.89 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-fluorophenyl)benzo[c][2,7]naphthyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-fluorophenyl)benzo[c][2,7]naphthyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 176751456 |
| Molecular Formula | C37H32FIrN2O2- |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 748.21 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-fluorophenyl)benzo[c][2,7]naphthyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC(C)(C)c1cc(-c2nccc3c2cnc2cc(-c4ccccc4F)ccc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C32H24FN2.C5H8O2.Ir/c1-32(2,3)28-17-22(16-20-8-4-5-9-23(20)28)31-27-19-35-30-18-21(24-10-6-7-11-29(24)33)12-13-26(30)25(27)14-15-34-31;1-4(6)3-5(2)7;/h4-15,17-19H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | OYHWDGBMFIJKOU-LWFKIUJUSA-N |
| XLogP | 9.54 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|