C29H20FIrN2O2- — CID 177293361
7-fluoro-4-(4-isocyano-1H-naphthalen-1-id-2-yl)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 177293361) has the molecular formula C29H20FIrN2O2- and a molecular weight of 639.71 g/mol. Its IUPAC name is 7-fluoro-4-(4-isocyano-1H-naphthalen-1-id-2-yl)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 7-fluoro-4-(4-isocyano-1H-naphthalen-1-id-2-yl)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 177293361 |
| Molecular Formula | C29H20FIrN2O2- |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 7-fluoro-4-(4-isocyano-1H-naphthalen-1-id-2-yl)benzo[f]isoquinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[C-]#[N+]c1cc(-c2nccc3c2ccc2c(F)cccc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C24H12FN2.C5H8O2.Ir/c1-26-23-14-16(13-15-5-2-3-6-17(15)23)24-21-10-9-20-18(7-4-8-22(20)25)19(21)11-12-27-24;1-4(6)3-5(2)7;/h2-12,14H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VLMUCTQHOVCLTP-LWFKIUJUSA-N |
| XLogP | 7.73 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|