C28H28IrNO2S- — CID 170678751
4,5-dimethyl-13-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 170678751) has the molecular formula C28H28IrNO2S- and a molecular weight of 634.82 g/mol. Its IUPAC name is 4,5-dimethyl-13-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4,5-dimethyl-13-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 170678751 |
| Molecular Formula | C28H28IrNO2S- |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 4,5-dimethyl-13-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC1Cc2ccc3sc4c(-c5[c-]cccc5)nccc4c3c2CC1C.[Ir] |
| InChI | InChI=1S/C23H20NS.C5H8O2.Ir/c1-14-12-17-8-9-20-21(19(17)13-15(14)2)18-10-11-24-22(23(18)25-20)16-6-4-3-5-7-16;1-4(6)3-5(2)7;/h3-6,8-11,14-15H,12-13H2,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | PPAATWIAXTXHMT-LWFKIUJUSA-N |
| XLogP | 7.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|