C26H19F6IrN2O2- — CID 168852592
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium;7-phenyl-3-propan-2-yl-2,8-phenanthroline (PubChem CID 168852592) has the molecular formula C26H19F6IrN2O2- and a molecular weight of 697.66 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium;7-phenyl-3-propan-2-yl-2,8-phenanthroline.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium;7-phenyl-3-propan-2-yl-2,8-phenanthroline |
|---|---|
| PubChem CID | 168852592 |
| Molecular Formula | C26H19F6IrN2O2- |
| Molecular Weight | 697.66 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium;7-phenyl-3-propan-2-yl-2,8-phenanthroline |
| SMILES | CC(C)c1cc2ccc3c(-c4[c-]cccc4)nccc3c2cn1.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C21H17N2.C5H2F6O2.Ir/c1-14(2)20-12-16-8-9-18-17(19(16)13-23-20)10-11-22-21(18)15-6-4-3-5-7-15;6-4(7,8)2(12)1-3(13)5(9,10)11;/h3-6,8-14H,1-2H3;1,12H;/q-1;;/b;2-1-; |
| InChIKey | JBTTULFFTQAYFS-FJOGWHKWSA-N |
| XLogP | 7.49 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|