C29H36IrNO2- — CID 168744189
(Z)-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;1-phenyl-6-propan-2-ylisoquinoline (PubChem CID 168744189) has the molecular formula C29H36IrNO2- and a molecular weight of 622.83 g/mol. Its IUPAC name is (Z)-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;1-phenyl-6-propan-2-ylisoquinoline.
| Compound Name | (Z)-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;1-phenyl-6-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 168744189 |
| Molecular Formula | C29H36IrNO2- |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | (Z)-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;1-phenyl-6-propan-2-ylisoquinoline |
| SMILES | CC(C)c1ccc2c(-c3[c-]cccc3)nccc2c1.CCC(C)C(=O)/C=C(\O)C(C)CC.[Ir] |
| InChI | InChI=1S/C18H16N.C11H20O2.Ir/c1-13(2)15-8-9-17-16(12-15)10-11-19-18(17)14-6-4-3-5-7-14;1-5-8(3)10(12)7-11(13)9(4)6-2;/h3-6,8-13H,1-2H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | INNBATOXELOLPO-YAJOTRLJSA-N |
| XLogP | 7.91 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|