C33H44IrNO2- — CID 177119847
1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-methylpropyl)isoquinoline;(Z)-6-hydroxy-3,7,8-trimethylnon-5-en-4-one;iridium (PubChem CID 177119847) has the molecular formula C33H44IrNO2- and a molecular weight of 678.94 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-methylpropyl)isoquinoline;(Z)-6-hydroxy-3,7,8-trimethylnon-5-en-4-one;iridium.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-methylpropyl)isoquinoline;(Z)-6-hydroxy-3,7,8-trimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 177119847 |
| Molecular Formula | C33H44IrNO2- |
| Molecular Weight | 678.94 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-methylpropyl)isoquinoline;(Z)-6-hydroxy-3,7,8-trimethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)C(=O)/C=C(\O)C(C)C(C)C.Cc1[c-]c(-c2nccc3cc(CC(C)C)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C21H22N.C12H22O2.Ir/c1-14(2)9-17-5-6-20-18(13-17)7-8-22-21(20)19-11-15(3)10-16(4)12-19;1-6-9(4)11(13)7-12(14)10(5)8(2)3;/h5-8,10-11,13-14H,9H2,1-4H3;7-10,14H,6H2,1-5H3;/q-1;;/b;12-7-; |
| InChIKey | HPBAOZNLZWDNFU-BGNIYPAZSA-N |
| XLogP | 8.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.94 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|