C18H16N- — CID 102348703
1-(3-propan-2-ylbenzene-6-id-1-yl)isoquinoline (PubChem CID 102348703) has the molecular formula C18H16N- and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(3-propan-2-ylbenzene-6-id-1-yl)isoquinoline.
| Compound Name | 1-(3-propan-2-ylbenzene-6-id-1-yl)isoquinoline |
|---|---|
| PubChem CID | 102348703 |
| Molecular Formula | C18H16N- |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-(3-propan-2-ylbenzene-6-id-1-yl)isoquinoline |
| SMILES | CC(C)c1cc[c-]c(-c2nccc3ccccc23)c1 |
| InChI | InChI=1S/C18H16N/c1-13(2)15-7-5-8-16(12-15)18-17-9-4-3-6-14(17)10-11-19-18/h3-7,9-13H,1-2H3/q-1 |
| InChIKey | QQTRIQDTWPPPOB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|