C37H40IrNO3- — CID 170679254
(Z)-4-hydroxypent-3-en-2-one;iridium;4,4,7,7-tetramethyl-15-(4-propan-2-yl-2H-naphthalen-2-id-1-yl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene (PubChem CID 170679254) has the molecular formula C37H40IrNO3- and a molecular weight of 738.95 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4,4,7,7-tetramethyl-15-(4-propan-2-yl-2H-naphthalen-2-id-1-yl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4,4,7,7-tetramethyl-15-(4-propan-2-yl-2H-naphthalen-2-id-1-yl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170679254 |
| Molecular Formula | C37H40IrNO3- |
| Molecular Weight | 738.95 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4,4,7,7-tetramethyl-15-(4-propan-2-yl-2H-naphthalen-2-id-1-yl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1c[c-]c(-c2nccc3c2oc2cc4c(cc23)C(C)(C)CCC4(C)C)c2ccccc12.[Ir] |
| InChI | InChI=1S/C32H32NO.C5H8O2.Ir/c1-19(2)20-11-12-23(22-10-8-7-9-21(20)22)29-30-24(13-16-33-29)25-17-26-27(18-28(25)34-30)32(5,6)15-14-31(26,3)4;1-4(6)3-5(2)7;/h7-11,13,16-19H,14-15H2,1-6H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WRPOHDORNKSFCP-LWFKIUJUSA-N |
| XLogP | 10.11 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.95 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|