C16H18Cl2N3Pt- — CID 23597304
azanide;dichloroplatinum;3,4,7,8-tetramethyl-1,10-phenanthroline (PubChem CID 23597304) has the molecular formula C16H18Cl2N3Pt- and a molecular weight of 518.33 g/mol. Its IUPAC name is azanide;dichloroplatinum;3,4,7,8-tetramethyl-1,10-phenanthroline.
| Compound Name | azanide;dichloroplatinum;3,4,7,8-tetramethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 23597304 |
| Molecular Formula | C16H18Cl2N3Pt- |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | azanide;dichloroplatinum;3,4,7,8-tetramethyl-1,10-phenanthroline |
| SMILES | Cc1cnc2c(ccc3c(C)c(C)cnc32)c1C.Cl[Pt]Cl.[NH2-] |
| InChI | InChI=1S/C16H16N2.2ClH.H2N.Pt/c1-9-7-17-15-13(11(9)3)5-6-14-12(4)10(2)8-18-16(14)15;;;;/h5-8H,1-4H3;2*1H;1H2;/q;;;-1;+2/p-2 |
| InChIKey | WHPWMNYXJRKLMC-UHFFFAOYSA-L |
| XLogP | 6.11 |
| TPSA | 59.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|