C30H26N4 — CID 123787432
3,4,7-trimethyl-8-[2-(8-methyl-1,10-phenanthrolin-3-yl)ethyl]-1,10-phenanthroline (PubChem CID 123787432) has the molecular formula C30H26N4 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3,4,7-trimethyl-8-[2-(8-methyl-1,10-phenanthrolin-3-yl)ethyl]-1,10-phenanthroline.
| Compound Name | 3,4,7-trimethyl-8-[2-(8-methyl-1,10-phenanthrolin-3-yl)ethyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 123787432 |
| Molecular Formula | C30H26N4 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3,4,7-trimethyl-8-[2-(8-methyl-1,10-phenanthrolin-3-yl)ethyl]-1,10-phenanthroline |
| SMILES | Cc1cnc2c(ccc3cc(CCc4cnc5c(ccc6c(C)c(C)cnc65)c4C)cnc32)c1 |
| InChI | InChI=1S/C30H26N4/c1-17-11-22-7-8-23-12-21(15-33-28(23)27(22)31-13-17)5-6-24-16-34-30-26(20(24)4)10-9-25-19(3)18(2)14-32-29(25)30/h7-16H,5-6H2,1-4H3 |
| InChIKey | CQDAYOIFCXPZPB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|