C57H52N8 — CID 160893139
2,9-dimethyl-1,10-phenanthroline;3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline;5,6-dimethyl-1,10-phenanthroline;methane (PubChem CID 160893139) has the molecular formula C57H52N8 and a molecular weight of 849.10 g/mol. Its IUPAC name is 2,9-dimethyl-1,10-phenanthroline;3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline;5,6-dimethyl-1,10-phenanthroline;methane.
| Compound Name | 2,9-dimethyl-1,10-phenanthroline;3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline;5,6-dimethyl-1,10-phenanthroline;methane |
|---|---|
| PubChem CID | 160893139 |
| Molecular Formula | C57H52N8 |
| Molecular Weight | 849.10 g/mol |
| Exact Mass | 848.43 |
| IUPAC Name | 2,9-dimethyl-1,10-phenanthroline;3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline;5,6-dimethyl-1,10-phenanthroline;methane |
| SMILES | C.Cc1c(C)c2cccnc2c2ncccc12.Cc1ccc2ccc3ccc(C)nc3c2n1.Cc1ccnc2c1ccc1c(C)ccnc12.Cc1cnc2c(ccc3cc(C)cnc32)c1 |
| InChI | InChI=1S/4C14H12N2.CH4/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;1-9-5-11-3-4-12-6-10(2)8-16-14(12)13(11)15-7-9;1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13;/h4*3-8H,1-2H3;1H4 |
| InChIKey | SONOLLKGSAXSMM-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.10 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|