C28H24N4 — CID 175546630
3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline (PubChem CID 175546630) has the molecular formula C28H24N4 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline.
| Compound Name | 3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 175546630 |
| Molecular Formula | C28H24N4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3,8-dimethyl-1,10-phenanthroline;4,7-dimethyl-1,10-phenanthroline |
| SMILES | Cc1ccnc2c1ccc1c(C)ccnc12.Cc1cnc2c(ccc3cc(C)cnc32)c1 |
| InChI | InChI=1S/2C14H12N2/c1-9-5-11-3-4-12-6-10(2)8-16-14(12)13(11)15-7-9;1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h2*3-8H,1-2H3 |
| InChIKey | HDHLHHAFIBKULL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|