C30H22N2 — CID 175072403
3-methylfluoranthene;3-methyl-1,7-phenanthroline (PubChem CID 175072403) has the molecular formula C30H22N2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-methylfluoranthene;3-methyl-1,7-phenanthroline.
| Compound Name | 3-methylfluoranthene;3-methyl-1,7-phenanthroline |
|---|---|
| PubChem CID | 175072403 |
| Molecular Formula | C30H22N2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-methylfluoranthene;3-methyl-1,7-phenanthroline |
| SMILES | Cc1ccc2c3c(cccc13)-c1ccccc1-2.Cc1cnc2c(ccc3ncccc32)c1 |
| InChI | InChI=1S/C17H12.C13H10N2/c1-11-9-10-16-14-6-3-2-5-13(14)15-8-4-7-12(11)17(15)16;1-9-7-10-4-5-12-11(3-2-6-14-12)13(10)15-8-9/h2-10H,1H3;2-8H,1H3 |
| InChIKey | WTRKPHLKTOZOBA-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|