C26H29N3 — CID 70904890
2-[2-(4-tert-butyl-2-methylphenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine (PubChem CID 70904890) has the molecular formula C26H29N3 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[2-(4-tert-butyl-2-methylphenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine.
| Compound Name | 2-[2-(4-tert-butyl-2-methylphenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 70904890 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 2-[2-(4-tert-butyl-2-methylphenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(C(C)(C)C)cc3C)cc12 |
| InChI | InChI=1S/C26H29N3/c1-16-6-11-21-22-14-18(15-28-24(22)25(27)29-23(21)12-16)7-8-19-9-10-20(13-17(19)2)26(3,4)5/h6,9-15H,7-8H2,1-5H3,(H2,27,29) |
| InChIKey | OEEVTNQWEYQOIS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|