C28H34N3O3P — CID 121440387
5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]pentyl-methylphosphinic acid (PubChem CID 121440387) has the molecular formula C28H34N3O3P and a molecular weight of 491.57 g/mol. Its IUPAC name is 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]pentyl-methylphosphinic acid.
| Compound Name | 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]pentyl-methylphosphinic acid |
|---|---|
| PubChem CID | 121440387 |
| Molecular Formula | C28H34N3O3P |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]pentyl-methylphosphinic acid |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(OCCCCCP(C)(=O)O)cc3C)cc12 |
| InChI | InChI=1S/C28H34N3O3P/c1-19-7-12-24-25-17-21(18-30-27(25)28(29)31-26(24)15-19)8-9-22-10-11-23(16-20(22)2)34-13-5-4-6-14-35(3,32)33/h7,10-12,15-18H,4-6,8-9,13-14H2,1-3H3,(H2,29,31)(H,32,33) |
| InChIKey | HAUWNFCQOYXGDD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|