C27H31N2O2P — CID 91539645
5-ethyl-2-[2-[4-[ethyl(methyl)phosphoryl]oxy-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridine (PubChem CID 91539645) has the molecular formula C27H31N2O2P and a molecular weight of 446.53 g/mol. Its IUPAC name is 5-ethyl-2-[2-[4-[ethyl(methyl)phosphoryl]oxy-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridine.
| Compound Name | 5-ethyl-2-[2-[4-[ethyl(methyl)phosphoryl]oxy-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridine |
|---|---|
| PubChem CID | 91539645 |
| Molecular Formula | C27H31N2O2P |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 5-ethyl-2-[2-[4-[ethyl(methyl)phosphoryl]oxy-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridine |
| SMILES | CCc1nc2cc(C)ccc2c2cc(CCc3ccc(OP(C)(=O)CC)cc3C)cnc12 |
| InChI | InChI=1S/C27H31N2O2P/c1-6-25-27-24(23-13-8-18(3)14-26(23)29-25)16-20(17-28-27)9-10-21-11-12-22(15-19(21)4)31-32(5,30)7-2/h8,11-17H,6-7,9-10H2,1-5H3 |
| InChIKey | XEUZUCRISYKTCF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|