C48H62N4O8 — CID 58481155
4-[[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]methyl]-N-[3-[2-[2-[7-(2-ethoxyethoxy)-5-oxoheptoxy]ethoxy]ethoxy]propyl]benzamide (PubChem CID 58481155) has the molecular formula C48H62N4O8 and a molecular weight of 823.04 g/mol. Its IUPAC name is 4-[[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]methyl]-N-[3-[2-[2-[7-(2-ethoxyethoxy)-5-oxoheptoxy]ethoxy]ethoxy]propyl]benzamide.
| Compound Name | 4-[[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]methyl]-N-[3-[2-[2-[7-(2-ethoxyethoxy)-5-oxoheptoxy]ethoxy]ethoxy]propyl]benzamide |
|---|---|
| PubChem CID | 58481155 |
| Molecular Formula | C48H62N4O8 |
| Molecular Weight | 823.04 g/mol |
| Exact Mass | 822.46 |
| IUPAC Name | 4-[[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]methyl]-N-[3-[2-[2-[7-(2-ethoxyethoxy)-5-oxoheptoxy]ethoxy]ethoxy]propyl]benzamide |
| SMILES | CCOCCOCCC(=O)CCCCOCCOCCOCCCNC(=O)c1ccc(COc2ccc(CCc3cnc4c(N)nc5cc(C)ccc5c4c3)c(C)c2)cc1 |
| InChI | InChI=1S/C48H62N4O8/c1-4-55-24-25-58-23-19-41(53)8-5-6-21-56-26-28-59-29-27-57-22-7-20-50-48(54)40-14-10-37(11-15-40)34-60-42-17-16-39(36(3)31-42)13-12-38-32-44-43-18-9-35(2)30-45(43)52-47(49)46(44)51-33-38/h9-11,14-18,30-33H,4-8,12-13,19-29,34H2,1-3H3,(H2,49,52)(H,50,54) |
| InChIKey | NEXKDEGHZKBNGG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.04 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|