C34H42F2N3O6P — CID 58166519
4-[5-amino-2-[2-[4-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]butan-2-one (PubChem CID 58166519) has the molecular formula C34H42F2N3O6P and a molecular weight of 657.69 g/mol. Its IUPAC name is 4-[5-amino-2-[2-[4-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]butan-2-one.
| Compound Name | 4-[5-amino-2-[2-[4-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]butan-2-one |
|---|---|
| PubChem CID | 58166519 |
| Molecular Formula | C34H42F2N3O6P |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | 4-[5-amino-2-[2-[4-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]butan-2-one |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCCOc1ccc(CCc2cnc3c(N)nc4cc(CCC(C)=O)ccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C34H42F2N3O6P/c1-5-44-46(41,45-6-2)34(35,36)15-16-42-17-18-43-28-13-12-27(23(3)19-28)11-9-26-20-30-29-14-10-25(8-7-24(4)40)21-31(29)39-33(37)32(30)38-22-26/h10,12-14,19-22H,5-9,11,15-18H2,1-4H3,(H2,37,39) |
| InChIKey | FKEPWSUMVZTDDZ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|