C27H30F2N3O5P — CID 87255838
2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethylperoxy-(1,1-difluoropropyl)phosphinic acid (PubChem CID 87255838) has the molecular formula C27H30F2N3O5P and a molecular weight of 545.52 g/mol. Its IUPAC name is 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethylperoxy-(1,1-difluoropropyl)phosphinic acid.
| Compound Name | 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethylperoxy-(1,1-difluoropropyl)phosphinic acid |
|---|---|
| PubChem CID | 87255838 |
| Molecular Formula | C27H30F2N3O5P |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethylperoxy-(1,1-difluoropropyl)phosphinic acid |
| SMILES | CCC(F)(F)P(=O)(O)OOCCOc1ccc(CCc2cnc3c(N)nc4cc(C)ccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C27H30F2N3O5P/c1-4-27(28,29)38(33,34)37-36-12-11-35-21-9-8-20(18(3)14-21)7-6-19-15-23-22-10-5-17(2)13-24(22)32-26(30)25(23)31-16-19/h5,8-10,13-16H,4,6-7,11-12H2,1-3H3,(H2,30,32)(H,33,34) |
| InChIKey | ZARWBRPWMUNPAH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|