C32H40F2N3O4P — CID 86651459
2-[2-[4-(6-diethoxyphosphoryl-6,6-difluorohexoxy)-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine (PubChem CID 86651459) has the molecular formula C32H40F2N3O4P and a molecular weight of 599.66 g/mol. Its IUPAC name is 2-[2-[4-(6-diethoxyphosphoryl-6,6-difluorohexoxy)-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine.
| Compound Name | 2-[2-[4-(6-diethoxyphosphoryl-6,6-difluorohexoxy)-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 86651459 |
| Molecular Formula | C32H40F2N3O4P |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | 2-[2-[4-(6-diethoxyphosphoryl-6,6-difluorohexoxy)-2-methylphenyl]ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCCCCOc1ccc(CCc2cnc3c(N)nc4cc(C)ccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C32H40F2N3O4P/c1-5-40-42(38,41-6-2)32(33,34)16-8-7-9-17-39-26-14-13-25(23(4)19-26)12-11-24-20-28-27-15-10-22(3)18-29(27)37-31(35)30(28)36-21-24/h10,13-15,18-21H,5-9,11-12,16-17H2,1-4H3,(H2,35,37) |
| InChIKey | CBEYKRNDGUZQAH-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|