C30H34F2N3O6P — CID 67128028
[4-[4-[2-[5-amino-8-(3-ethoxy-3-oxopropyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]-1,1-difluorobutyl]phosphonic acid (PubChem CID 67128028) has the molecular formula C30H34F2N3O6P and a molecular weight of 601.59 g/mol. Its IUPAC name is [4-[4-[2-[5-amino-8-(3-ethoxy-3-oxopropyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]-1,1-difluorobutyl]phosphonic acid.
| Compound Name | [4-[4-[2-[5-amino-8-(3-ethoxy-3-oxopropyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]-1,1-difluorobutyl]phosphonic acid |
|---|---|
| PubChem CID | 67128028 |
| Molecular Formula | C30H34F2N3O6P |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [4-[4-[2-[5-amino-8-(3-ethoxy-3-oxopropyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]-1,1-difluorobutyl]phosphonic acid |
| SMILES | CCOC(=O)CCc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(OCCCC(F)(F)P(=O)(O)O)cc3C)cc12 |
| InChI | InChI=1S/C30H34F2N3O6P/c1-3-40-27(36)12-7-20-6-11-24-25-16-21(18-34-28(25)29(33)35-26(24)17-20)5-8-22-9-10-23(15-19(22)2)41-14-4-13-30(31,32)42(37,38)39/h6,9-11,15-18H,3-5,7-8,12-14H2,1-2H3,(H2,33,35)(H2,37,38,39) |
| InChIKey | VHVLNVHMUFRXFM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|