C28H31N3O3 — CID 67127816
ethyl 3-[5-amino-2-[2-[4-(methoxymethyl)-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]propanoate (PubChem CID 67127816) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is ethyl 3-[5-amino-2-[2-[4-(methoxymethyl)-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]propanoate.
| Compound Name | ethyl 3-[5-amino-2-[2-[4-(methoxymethyl)-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]propanoate |
|---|---|
| PubChem CID | 67127816 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | ethyl 3-[5-amino-2-[2-[4-(methoxymethyl)-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-8-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(COC)cc3C)cc12 |
| InChI | InChI=1S/C28H31N3O3/c1-4-34-26(32)12-8-19-7-11-23-24-14-20(16-30-27(24)28(29)31-25(23)15-19)5-9-22-10-6-21(17-33-3)13-18(22)2/h6-7,10-11,13-16H,4-5,8-9,12,17H2,1-3H3,(H2,29,31) |
| InChIKey | WUFSKQUIBNJFCO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|