C28H31N3O6P+ — CID 126660183
2-[2-[4-[2-[5-amino-8-(2-carboxyethyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]ethoxy]ethyl-hydroxy-oxophosphanium (PubChem CID 126660183) has the molecular formula C28H31N3O6P+ and a molecular weight of 536.55 g/mol. Its IUPAC name is 2-[2-[4-[2-[5-amino-8-(2-carboxyethyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]ethoxy]ethyl-hydroxy-oxophosphanium.
| Compound Name | 2-[2-[4-[2-[5-amino-8-(2-carboxyethyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]ethoxy]ethyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 126660183 |
| Molecular Formula | C28H31N3O6P+ |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[2-[4-[2-[5-amino-8-(2-carboxyethyl)benzo[f][1,7]naphthyridin-2-yl]ethyl]-3-methylphenoxy]ethoxy]ethyl-hydroxy-oxophosphanium |
| SMILES | Cc1cc(OCCOCC[P+](=O)O)ccc1CCc1cnc2c(N)nc3cc(CCC(=O)O)ccc3c2c1 |
| InChI | InChI=1S/C28H30N3O6P/c1-18-14-22(37-11-10-36-12-13-38(34)35)7-6-21(18)5-2-20-15-24-23-8-3-19(4-9-26(32)33)16-25(23)31-28(29)27(24)30-17-20/h3,6-8,14-17H,2,4-5,9-13H2,1H3,(H3-,29,31,32,33,34,35)/p+1 |
| InChIKey | GYMSJNZISMLLDH-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|