C28H31N3O3 — CID 67380152
5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenoxy]heptanoic acid (PubChem CID 67380152) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenoxy]heptanoic acid.
| Compound Name | 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 67380152 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 5-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenoxy]heptanoic acid |
| SMILES | CCC(CCCC(=O)O)Oc1ccc(CCc2cnc3c(N)nc4cc(C)ccc4c3c2)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-3-21(5-4-6-26(32)33)34-22-12-10-19(11-13-22)8-9-20-16-24-23-14-7-18(2)15-25(23)31-28(29)27(24)30-17-20/h7,10-17,21H,3-6,8-9H2,1-2H3,(H2,29,31)(H,32,33) |
| InChIKey | LKCGNVUPTNESRK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|