C26H28N4O2 — CID 66890643
3-[1-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenyl]ethylamino]propanoic acid (PubChem CID 66890643) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[1-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenyl]ethylamino]propanoic acid.
| Compound Name | 3-[1-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 66890643 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[1-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]phenyl]ethylamino]propanoic acid |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(C(C)NCCC(=O)O)cc3)cc12 |
| InChI | InChI=1S/C26H28N4O2/c1-16-3-10-21-22-14-19(15-29-25(22)26(27)30-23(21)13-16)5-4-18-6-8-20(9-7-18)17(2)28-12-11-24(31)32/h3,6-10,13-15,17,28H,4-5,11-12H2,1-2H3,(H2,27,30)(H,31,32) |
| InChIKey | CWENQCQBTQJCFP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|