C27H29N3O2 — CID 135379407
phenyl 2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylpentanoate (PubChem CID 135379407) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is phenyl 2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylpentanoate.
| Compound Name | phenyl 2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylpentanoate |
|---|---|
| PubChem CID | 135379407 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | phenyl 2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylpentanoate |
| SMILES | CCC(C)C(CCc1cnc2c(N)nc3cc(C)ccc3c2c1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C27H29N3O2/c1-4-18(3)21(27(31)32-20-8-6-5-7-9-20)13-11-19-15-23-22-12-10-17(2)14-24(22)30-26(28)25(23)29-16-19/h5-10,12,14-16,18,21H,4,11,13H2,1-3H3,(H2,28,30) |
| InChIKey | BRAXWMXRKUDAKB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|