C25H21N3O2 — CID 66892595
ethyl 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethynyl]-3-methylbenzoate (PubChem CID 66892595) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethynyl]-3-methylbenzoate.
| Compound Name | ethyl 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethynyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 66892595 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethynyl]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2cnc3c(N)nc4cc(C)ccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C25H21N3O2/c1-4-30-25(29)19-9-8-18(16(3)12-19)7-6-17-13-21-20-10-5-15(2)11-22(20)28-24(26)23(21)27-14-17/h5,8-14H,4H2,1-3H3,(H2,26,28) |
| InChIKey | GVNUXSDSOZXTIU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|