C24H15Cl3N4O2 — CID 159984350
3,5-dichloropyridine-2-carbonitrile;ethyl 4-[2-(5-chloro-6-cyano-3-pyridinyl)ethynyl]-3-methylbenzoate (PubChem CID 159984350) has the molecular formula C24H15Cl3N4O2 and a molecular weight of 497.77 g/mol. Its IUPAC name is 3,5-dichloropyridine-2-carbonitrile;ethyl 4-[2-(5-chloro-6-cyano-3-pyridinyl)ethynyl]-3-methylbenzoate.
| Compound Name | 3,5-dichloropyridine-2-carbonitrile;ethyl 4-[2-(5-chloro-6-cyano-3-pyridinyl)ethynyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 159984350 |
| Molecular Formula | C24H15Cl3N4O2 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 3,5-dichloropyridine-2-carbonitrile;ethyl 4-[2-(5-chloro-6-cyano-3-pyridinyl)ethynyl]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2cnc(C#N)c(Cl)c2)c(C)c1.N#Cc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13ClN2O2.C6H2Cl2N2/c1-3-23-18(22)15-7-6-14(12(2)8-15)5-4-13-9-16(19)17(10-20)21-11-13;7-4-1-5(8)6(2-9)10-3-4/h6-9,11H,3H2,1-2H3;1,3H |
| InChIKey | OGDIMBQOOMHPON-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 99.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|