About ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate
ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate (PubChem CID 43839924) has the molecular formula C14H11N3O3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate |
| PubChem CID | 43839924 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)ncc1c(=O)nc(N)sc12 |
| InChI | InChI=1S/C14H11N3O3S/c1-2-20-13(19)7-3-4-8-10(5-7)16-6-9-11(8)21-14(15)17-12(9)18/h3-6H,2H2,1H3,(H2,15,17,18) |
| InChIKey | ZSHAJVJHMSHQER-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate?
The IUPAC name of ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate (CID 43839924) is ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate.
What is the SMILES notation for ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate?
The canonical SMILES for ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate is CCOC(=O)c1ccc2c(c1)ncc1c(=O)nc(N)sc12.
What is the InChIKey of ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate?
The InChIKey is ZSHAJVJHMSHQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3S/c1-2-20-13(19)7-3-4-8-10(5-7)16-6-9-11(8)21-14(15)17-12(9)18/h3-6H,2H2,1H3,(H2,15,17,18).
What are the key properties of ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate?
ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate has a molecular weight of 301.33 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate is sourced from PubChem (CID 43839924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).