C14H11N3O3S — CID 43839924
ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate (PubChem CID 43839924) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate.
| Compound Name | ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 43839924 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | ethyl 2-amino-4-oxo-[1,3]thiazino[5,6-c]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)ncc1c(=O)nc(N)sc12 |
| InChI | InChI=1S/C14H11N3O3S/c1-2-20-13(19)7-3-4-8-10(5-7)16-6-9-11(8)21-14(15)17-12(9)18/h3-6H,2H2,1H3,(H2,15,17,18) |
| InChIKey | ZSHAJVJHMSHQER-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|