C29H32N4O3 — CID 150331174
4-[[2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylbenzoyl]amino]-4-methylpentanoic acid (PubChem CID 150331174) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[[2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylbenzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylbenzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 150331174 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-[[2-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylbenzoyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3c(C)cccc3C(=O)NC(C)(C)CCC(=O)O)cc12 |
| InChI | InChI=1S/C29H32N4O3/c1-17-8-10-21-23-15-19(16-31-26(23)27(30)32-24(21)14-17)9-11-20-18(2)6-5-7-22(20)28(36)33-29(3,4)13-12-25(34)35/h5-8,10,14-16H,9,11-13H2,1-4H3,(H2,30,32)(H,33,36)(H,34,35) |
| InChIKey | GPSAPPYMFLXBEG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|