C28H30N3O5P — CID 141474241
3-[10-amino-3-[2-[2-methyl-4-[2-(2-phosphorosoethoxy)ethoxy]phenyl]ethyl]benzo[f][1,7]naphthyridin-7-yl]propanoic acid (PubChem CID 141474241) has the molecular formula C28H30N3O5P and a molecular weight of 519.54 g/mol. Its IUPAC name is 3-[10-amino-3-[2-[2-methyl-4-[2-(2-phosphorosoethoxy)ethoxy]phenyl]ethyl]benzo[f][1,7]naphthyridin-7-yl]propanoic acid.
| Compound Name | 3-[10-amino-3-[2-[2-methyl-4-[2-(2-phosphorosoethoxy)ethoxy]phenyl]ethyl]benzo[f][1,7]naphthyridin-7-yl]propanoic acid |
|---|---|
| PubChem CID | 141474241 |
| Molecular Formula | C28H30N3O5P |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3-[10-amino-3-[2-[2-methyl-4-[2-(2-phosphorosoethoxy)ethoxy]phenyl]ethyl]benzo[f][1,7]naphthyridin-7-yl]propanoic acid |
| SMILES | Cc1cc(OCCOCCP=O)ccc1CCc1ccc2c(cnc3c(CCC(=O)O)ccc(N)c32)n1 |
| InChI | InChI=1S/C28H30N3O5P/c1-18-16-22(36-13-12-35-14-15-37-34)8-3-19(18)2-6-21-7-9-23-25(31-21)17-30-28-20(5-11-26(32)33)4-10-24(29)27(23)28/h3-4,7-10,16-17H,2,5-6,11-15,29H2,1H3,(H,32,33) |
| InChIKey | KGWVOIRLWHGFAN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|