C35H44F2N3O8P — CID 123150981
3-[5-amino-2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-1-yl]propanoic acid (PubChem CID 123150981) has the molecular formula C35H44F2N3O8P and a molecular weight of 703.72 g/mol. Its IUPAC name is 3-[5-amino-2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-1-yl]propanoic acid.
| Compound Name | 3-[5-amino-2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 123150981 |
| Molecular Formula | C35H44F2N3O8P |
| Molecular Weight | 703.72 g/mol |
| Exact Mass | 703.28 |
| IUPAC Name | 3-[5-amino-2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]benzo[f][1,7]naphthyridin-1-yl]propanoic acid |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCCOCCOc1ccc(CCc2cnc3c(N)nc4ccccc4c3c2CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C35H44F2N3O8P/c1-4-47-49(43,48-5-2)35(36,37)16-17-44-18-19-45-20-21-46-27-13-12-25(24(3)22-27)10-11-26-23-39-33-32(28(26)14-15-31(41)42)29-8-6-7-9-30(29)40-34(33)38/h6-9,12-13,22-23H,4-5,10-11,14-21H2,1-3H3,(H2,38,40)(H,41,42) |
| InChIKey | WKDRFDXOPNJALC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|