C37H50F2N3O6P — CID 123203776
2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]-8-pentylbenzo[f][1,7]naphthyridin-5-amine (PubChem CID 123203776) has the molecular formula C37H50F2N3O6P and a molecular weight of 701.79 g/mol. Its IUPAC name is 2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]-8-pentylbenzo[f][1,7]naphthyridin-5-amine.
| Compound Name | 2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]-8-pentylbenzo[f][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 123203776 |
| Molecular Formula | C37H50F2N3O6P |
| Molecular Weight | 701.79 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | 2-[2-[4-[2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethoxy]-2-methylphenyl]ethyl]-8-pentylbenzo[f][1,7]naphthyridin-5-amine |
| SMILES | CCCCCc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(OCCOCCOCCC(F)(F)P(=O)(OCC)OCC)cc3C)cc12 |
| InChI | InChI=1S/C37H50F2N3O6P/c1-5-8-9-10-28-12-16-32-33-24-29(26-41-35(33)36(40)42-34(32)25-28)11-13-30-14-15-31(23-27(30)4)46-22-21-45-20-19-44-18-17-37(38,39)49(43,47-6-2)48-7-3/h12,14-16,23-26H,5-11,13,17-22H2,1-4H3,(H2,40,42) |
| InChIKey | RYMJZVLJQXYXDS-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.79 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|