C29H35FN4O5P2 — CID 137289131
[3-[2-[2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethoxy]ethoxy]-1-fluoro-1-phosphanylpropyl]-hydroxyimino-oxidophosphanium (PubChem CID 137289131) has the molecular formula C29H35FN4O5P2 and a molecular weight of 600.57 g/mol. Its IUPAC name is [3-[2-[2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethoxy]ethoxy]-1-fluoro-1-phosphanylpropyl]-hydroxyimino-oxidophosphanium.
| Compound Name | [3-[2-[2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethoxy]ethoxy]-1-fluoro-1-phosphanylpropyl]-hydroxyimino-oxidophosphanium |
|---|---|
| PubChem CID | 137289131 |
| Molecular Formula | C29H35FN4O5P2 |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | [3-[2-[2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]ethoxy]ethoxy]-1-fluoro-1-phosphanylpropyl]-hydroxyimino-oxidophosphanium |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(OCCOCCOCCC(F)(P)[P+]([O-])=NO)cc3C)cc12 |
| InChI | InChI=1S/C29H35FN4O5P2/c1-19-3-8-24-25-17-21(18-32-27(25)28(31)33-26(24)15-19)4-5-22-6-7-23(16-20(22)2)39-14-13-38-12-11-37-10-9-29(30,40)41(36)34-35/h3,6-8,15-18,35H,4-5,9-14,40H2,1-2H3,(H2,31,33) |
| InChIKey | GWHIGBHWKHIFQO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|