C32H40F2N3O5P — CID 152566239
[6-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]-1,1-difluorohexyl] diethyl phosphate (PubChem CID 152566239) has the molecular formula C32H40F2N3O5P and a molecular weight of 615.66 g/mol. Its IUPAC name is [6-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]-1,1-difluorohexyl] diethyl phosphate.
| Compound Name | [6-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]-1,1-difluorohexyl] diethyl phosphate |
|---|---|
| PubChem CID | 152566239 |
| Molecular Formula | C32H40F2N3O5P |
| Molecular Weight | 615.66 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | [6-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]-1,1-difluorohexyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(F)(F)CCCCCOc1ccc(CCc2cnc3c(N)nc4cc(C)ccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C32H40F2N3O5P/c1-5-40-43(38,41-6-2)42-32(33,34)16-8-7-9-17-39-26-14-13-25(23(4)19-26)12-11-24-20-28-27-15-10-22(3)18-29(27)37-31(35)30(28)36-21-24/h10,13-15,18-21H,5-9,11-12,16-17H2,1-4H3,(H2,35,37) |
| InChIKey | YQNVKOZAVREPPM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.66 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|