C47H38N2 — CID 175635268
2-[5-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]-3,4,7,8-tetramethyl-1,10-phenanthroline (PubChem CID 175635268) has the molecular formula C47H38N2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 2-[5-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]-3,4,7,8-tetramethyl-1,10-phenanthroline.
| Compound Name | 2-[5-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]-3,4,7,8-tetramethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 175635268 |
| Molecular Formula | C47H38N2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 2-[5-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]-3,4,7,8-tetramethyl-1,10-phenanthroline |
| SMILES | Cc1cnc2c(ccc3c(C)c(C)c(-c4cccc5c(-c6ccc(-c7ccc8c(c7)C(C)(C)c7ccccc7-8)cc6)cccc45)nc32)c1C |
| InChI | InChI=1S/C47H38N2/c1-27-26-48-45-34(28(27)2)23-24-35-29(3)30(4)44(49-46(35)45)41-15-10-13-37-36(12-9-14-38(37)41)32-19-17-31(18-20-32)33-21-22-40-39-11-7-8-16-42(39)47(5,6)43(40)25-33/h7-26H,1-6H3 |
| InChIKey | KROPCVTXHDLJFA-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|