C8H10BF2- — CID 137328861
(4,5-difluoro-2-methylphenyl)-methylboranuide (PubChem CID 137328861) has the molecular formula C8H10BF2- and a molecular weight of 154.98 g/mol. Its IUPAC name is (4,5-difluoro-2-methylphenyl)-methylboranuide.
| Compound Name | (4,5-difluoro-2-methylphenyl)-methylboranuide |
|---|---|
| PubChem CID | 137328861 |
| Molecular Formula | C8H10BF2- |
| Molecular Weight | 154.98 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (4,5-difluoro-2-methylphenyl)-methylboranuide |
| SMILES | C[BH2-]c1cc(F)c(F)cc1C |
| InChI | InChI=1S/C8H10BF2/c1-5-3-7(10)8(11)4-6(5)9-2/h3-4H,9H2,1-2H3/q-1 |
| InChIKey | DSIQKMVOIIZFGV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.98 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|