About N-(4,5-difluoro-2-methylphenyl)methanimine
N-(4,5-difluoro-2-methylphenyl)methanimine (PubChem CID 123475442) has the molecular formula C8H7F2N
and a molecular weight of 155.15 g/mol. Its IUPAC name is N-(4,5-difluoro-2-methylphenyl)methanimine.
Molecular Properties
| Compound Name | N-(4,5-difluoro-2-methylphenyl)methanimine |
| PubChem CID | 123475442 |
| Molecular Formula | C8H7F2N |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-(4,5-difluoro-2-methylphenyl)methanimine |
| SMILES | C=Nc1cc(F)c(F)cc1C |
| InChI | InChI=1S/C8H7F2N/c1-5-3-6(9)7(10)4-8(5)11-2/h3-4H,2H2,1H3 |
| InChIKey | AQDIZCWERLCQCZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-difluoro-2-methylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-difluoro-2-methylphenyl)methanimine?
The IUPAC name of N-(4,5-difluoro-2-methylphenyl)methanimine (CID 123475442) is N-(4,5-difluoro-2-methylphenyl)methanimine.
What is the SMILES notation for N-(4,5-difluoro-2-methylphenyl)methanimine?
The canonical SMILES for N-(4,5-difluoro-2-methylphenyl)methanimine is C=Nc1cc(F)c(F)cc1C.
What is the InChIKey of N-(4,5-difluoro-2-methylphenyl)methanimine?
The InChIKey is AQDIZCWERLCQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2N/c1-5-3-6(9)7(10)4-8(5)11-2/h3-4H,2H2,1H3.
What are the key properties of N-(4,5-difluoro-2-methylphenyl)methanimine?
N-(4,5-difluoro-2-methylphenyl)methanimine has a molecular weight of 155.15 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-difluoro-2-methylphenyl)methanimine is sourced from PubChem (CID 123475442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).