C8H7F2N — CID 123475442
N-(4,5-difluoro-2-methylphenyl)methanimine (PubChem CID 123475442) has the molecular formula C8H7F2N and a molecular weight of 155.15 g/mol. Its IUPAC name is N-(4,5-difluoro-2-methylphenyl)methanimine.
| Compound Name | N-(4,5-difluoro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 123475442 |
| Molecular Formula | C8H7F2N |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-(4,5-difluoro-2-methylphenyl)methanimine |
| SMILES | C=Nc1cc(F)c(F)cc1C |
| InChI | InChI=1S/C8H7F2N/c1-5-3-6(9)7(10)4-8(5)11-2/h3-4H,2H2,1H3 |
| InChIKey | AQDIZCWERLCQCZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|