C25H28 — CID 59510092
1,2,3,4,5,6,7,9,10-nonamethylpyrene (PubChem CID 59510092) has the molecular formula C25H28 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,9,10-nonamethylpyrene.
| Compound Name | 1,2,3,4,5,6,7,9,10-nonamethylpyrene |
|---|---|
| PubChem CID | 59510092 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1,2,3,4,5,6,7,9,10-nonamethylpyrene |
| SMILES | Cc1cc2c(C)c(C)c3c(C)c(C)c(C)c4c(C)c(C)c(c1C)c2c34 |
| InChI | InChI=1S/C25H28/c1-11-10-20-14(4)17(7)22-15(5)13(3)16(6)23-19(9)18(8)21(12(11)2)24(20)25(22)23/h10H,1-9H3 |
| InChIKey | FEJQHCZTXGJDGZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|