C24H26 — CID 59510094
1,2,3,4,5,6,8,9-octamethylpyrene (PubChem CID 59510094) has the molecular formula C24H26 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9-octamethylpyrene.
| Compound Name | 1,2,3,4,5,6,8,9-octamethylpyrene |
|---|---|
| PubChem CID | 59510094 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1,2,3,4,5,6,8,9-octamethylpyrene |
| SMILES | Cc1c(C)c2cc(C)c3c(C)cc(C)c4c(C)c(C)c(c1C)c2c34 |
| InChI | InChI=1S/C24H26/c1-11-9-12(2)21-17(7)18(8)22-16(6)14(4)15(5)19-10-13(3)20(11)24(21)23(19)22/h9-10H,1-8H3 |
| InChIKey | QHURIRPZBYTYEZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|