C15H18O2S — CID 57481919
2,3,4,5,7-pentamethylnaphthalene-1-sulfinic acid (PubChem CID 57481919) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2,3,4,5,7-pentamethylnaphthalene-1-sulfinic acid.
| Compound Name | 2,3,4,5,7-pentamethylnaphthalene-1-sulfinic acid |
|---|---|
| PubChem CID | 57481919 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2,3,4,5,7-pentamethylnaphthalene-1-sulfinic acid |
| SMILES | Cc1cc(C)c2c(C)c(C)c(C)c(S(=O)O)c2c1 |
| InChI | InChI=1S/C15H18O2S/c1-8-6-9(2)14-11(4)10(3)12(5)15(18(16)17)13(14)7-8/h6-7H,1-5H3,(H,16,17) |
| InChIKey | OFPDWFWMUOYWCB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|